2-Amino-4-methylthiazole - CAS 1603-91-4
Catalog: |
BB011632 |
Product Name: |
2-Amino-4-methylthiazole |
CAS: |
1603-91-4 |
Synonyms: |
4-methyl-1,3-thiazol-2-amine |
IUPAC Name: | 4-methyl-1,3-thiazol-2-amine |
Description: | 2-Amino-4-methylthiazole (CAS# 1603-91-4) is a useful research chemical. |
Molecular Weight: | 114.17 |
Molecular Formula: | C4H6N2S |
Canonical SMILES: | CC1=CSC(=N1)N |
InChI: | InChI=1S/C4H6N2S/c1-3-2-7-4(5)6-3/h2H,1H3,(H2,5,6) |
InChI Key: | OUQMXTJYCAJLGO-UHFFFAOYSA-N |
Boiling Point: | 231-232 ℃ |
Density: | 1.202 g/cm3 (50 C) |
MDL: | MFCD00005329 |
LogP: | 1.61490 |
GHS Hazard Statement: | H302 (15.22%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-2018238079-A1 | Novel pyridone carboxylic acid derivative or salt thereof | 20170324 |
EP-3604305-A1 | Novel pyridone carboxylic acid derivative or salt thereof | 20170324 |
US-2020062752-A1 | Novel pyridone carboxylic acid derivative or salt thereof | 20170324 |
US-2019284189-A1 | Oxadiazolones as transient receptor potential channel inhibitors | 20161128 |
US-10913742-B2 | Oxadiazolones as transient receptor potential channel inhibitors | 20161128 |
PMID | Publication Date | Title | Journal |
22932314 | 20121001 | Novel pleuromutilin derivatives as antibacterial agents: synthesis, biological evaluation and molecular docking studies | Bioorganic & medicinal chemistry letters |
19072936 | 20090201 | N(G)-acylated aminothiazolylpropylguanidines as potent and selective histamine H(2) receptor agonists | ChemMedChem |
18529048 | 20080721 | Palladium(II) complexes of unsymmetrical CNN pincer ligands | Inorganic chemistry |
18477512 | 20080601 | Design, synthesis, and evaluation of potential inhibitors of nitric oxide synthase | Bioorganic & medicinal chemistry |
16839131 | 20060721 | Assessing the nitrogen and carbon nucleophilicities of 2-aminothiazoles through coupling with superelectrophilic 4,6-dinitrobenzofuroxan | The Journal of organic chemistry |
Complexity: | 66.7 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 114.02516937 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 114.02516937 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 67.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS