2-Amino-4-hydroxy-7-methoxyquinazoline - CAS 181871-74-9
Catalog: |
BB013846 |
Product Name: |
2-Amino-4-hydroxy-7-methoxyquinazoline |
CAS: |
181871-74-9 |
Synonyms: |
2-amino-7-methoxy-3H-quinazolin-4-one; 2-amino-7-methoxy-3H-quinazolin-4-one |
IUPAC Name: | 2-amino-7-methoxy-3H-quinazolin-4-one |
Description: | 2-Amino-4-hydroxy-7-methoxyquinazoline (CAS# 181871-74-9 ) is a useful research chemical. |
Molecular Weight: | 191.19 |
Molecular Formula: | C9H9N3O2 |
Canonical SMILES: | COC1=CC2=C(C=C1)C(=O)NC(=N2)N |
InChI: | InChI=1S/C9H9N3O2/c1-14-5-2-3-6-7(4-5)11-9(10)12-8(6)13/h2-4H,1H3,(H3,10,11,12,13) |
InChI Key: | QDZOJOIJLSSJRF-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
EP-2925729-B1 | Heterocyclic substituted 2-amino-quinazoline derivatives for the treatment of viral infections | 20121116 |
US-10253003-B2 | Heterocyclic substituted 2-amino quinazoline derivatives for the treatment of viral infections | 20121116 |
US-2015284339-A1 | Heterocyclic substituted 2-amino quinazoline derivatives for the treatment of viral infections | 20121116 |
US-2017349557-A1 | Heterocyclic substituted 2-amino quinazoline derivatives for the treatment of viral infections | 20121116 |
US-2019330160-A1 | Heterocyclic substituted 2-amino quinazoline derivatives for the treatment of viral infections | 20121116 |
Complexity: | 277 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.069476538 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.069476538 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 76.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS