2-Amino-4-chlorobenzaldehyde - CAS 59236-37-2
Catalog: |
BB030306 |
Product Name: |
2-Amino-4-chlorobenzaldehyde |
CAS: |
59236-37-2 |
Synonyms: |
2-amino-4-chlorobenzaldehyde; 2-amino-4-chlorobenzaldehyde |
IUPAC Name: | 2-amino-4-chlorobenzaldehyde |
Description: | 2-Amino-4-chlorobenzaldehyde (CAS# 59236-37-2) is a reagent used in the synthesis of pharmaceuticals such as robenidine analogues which are active against MRSA and VRE. |
Molecular Weight: | 155.58 |
Molecular Formula: | C7H6ClNO |
Canonical SMILES: | C1=CC(=C(C=C1Cl)N)C=O |
InChI: | InChI=1S/C7H6ClNO/c8-6-2-1-5(4-10)7(9)3-6/h1-4H,9H2 |
InChI Key: | WVXCOXXJTWKDPJ-UHFFFAOYSA-N |
LogP: | 2.31590 |
Publication Number | Title | Priority Date |
US-2019274306-A1 | 2-[3-(alkylsulfonyl)-2h-indazol-2-yl]-3h-imidazo[4,5-b]pyridine derivatives and similar compounds as pesticides | 20161123 |
WO-2018095953-A1 | 2-[3-(alkylsulfonyl)-2h-indazol-2-yl]-3h-imidazo[4,5-b]pyridine derivatives and similar compounds as pesticides | 20161123 |
EP-3544978-B1 | 2-[3-(alkylsulfonyl)-2h-indazol-2-yl]-3h-imidazo[4,5-b]pyridine derivatives and related compounds as pesticides | 20161123 |
US-10765116-B2 | 2-[3-(alkylsulfonyl)-2H-indazol-2-yl]-3H-imidazo[4,5-B]pyridine derivatives and similar compounds as pesticides | 20161123 |
AU-2016385839-A1 | Quinolin-2-one derivatives | 20160111 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 155.0137915 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 155.0137915 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 43.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS