2-Amino-4-chloro-5-(trifluoromethyl)aniline - CAS 157590-59-5
Catalog: |
BB011328 |
Product Name: |
2-Amino-4-chloro-5-(trifluoromethyl)aniline |
CAS: |
157590-59-5 |
Synonyms: |
4-chloro-5-(trifluoromethyl)benzene-1,2-diamine; 4-chloro-5-(trifluoromethyl)benzene-1,2-diamine |
IUPAC Name: | 4-chloro-5-(trifluoromethyl)benzene-1,2-diamine |
Description: | 2-Amino-4-chloro-5-(trifluoromethyl)aniline (CAS# 157590-59-5) is a useful research chemical. |
Molecular Weight: | 210.58 |
Molecular Formula: | C7H6ClF3N2 |
Canonical SMILES: | C1=C(C(=CC(=C1N)N)Cl)C(F)(F)F |
InChI: | InChI=1S/C7H6ClF3N2/c8-4-2-6(13)5(12)1-3(4)7(9,10)11/h1-2H,12-13H2 |
InChI Key: | BUSGYQISMPLVIJ-UHFFFAOYSA-N |
Boiling Point: | 305.1 °C at 760 mmHg |
Density: | 1.51 g/cm3 |
MDL: | MFCD00119550 |
LogP: | 3.68560 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020099511-A1 | Benzimidazole-2-methyl-morpholine derivatives | 20181114 |
WO-2020007964-A1 | 2-(2-azabicyclo[3.1.0]hexan-1-yl)-1h-benzimidazole derivatives | 20180705 |
AU-2017316742-A1 | Antibiotic compounds | 20160822 |
CA-3034000-A1 | Antibiotic compounds | 20160822 |
EP-3500567-A1 | Antibiotic compounds | 20160822 |
Complexity: | 185 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 210.0171604 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 210.0171604 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 52 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS