2-Amino-4,6-dichloro-5-isopropylpyrimidine - CAS 500161-46-6
Catalog: |
BB026892 |
Product Name: |
2-Amino-4,6-dichloro-5-isopropylpyrimidine |
CAS: |
500161-46-6 |
Synonyms: |
4,6-dichloro-5-propan-2-yl-2-pyrimidinamine; 4,6-dichloro-5-propan-2-ylpyrimidin-2-amine |
IUPAC Name: | 4,6-dichloro-5-propan-2-ylpyrimidin-2-amine |
Description: | 2-Amino-4,6-dichloro-5-isopropylpyrimidine (CAS# 500161-46-6 ) is a useful research chemical. |
Molecular Weight: | 206.07 |
Molecular Formula: | C7H9Cl2N3 |
Canonical SMILES: | CC(C)C1=C(N=C(N=C1Cl)N)Cl |
InChI: | InChI=1S/C7H9Cl2N3/c1-3(2)4-5(8)11-7(10)12-6(4)9/h3H,1-2H3,(H2,10,11,12) |
InChI Key: | ZIGZBWFRRSIFAH-UHFFFAOYSA-N |
Boiling Point: | 335.7 °C at 760 mmHg |
Density: | 1.354 g/cm3 |
LogP: | 2.25520 |
Publication Number | Title | Priority Date |
CZ-2011103-A3 | Pyrimidine compounds inhibiting formation of nitrogen monoxide and prostaglandin E2, preparation process and use thereof | 20110228 |
CZ-305457-B6 | Pyrimidine compounds inhibiting formation of nitrogen monoxide and prostaglandin E2, process for their preparation and use | 20110228 |
EP-2680847-A1 | Pyrimidine compounds inhibiting the formation of nitric oxide and prostaglandin e2, method of production thereof and use thereof | 20110228 |
EP-3195867-A1 | Pyrimidine compounds inhibiting the formation of nitric oxide and prostaglandin e2, method of production thereof and use thereof | 20110228 |
EP-3195867-B1 | Pyrimidine compounds inhibiting the formation of nitric oxide and prostaglandin e2, method of production thereof and use thereof | 20110228 |
Complexity: | 142 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.0173527 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.0173527 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 51.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS