2-Amino-4,5-dimethylthiazole - CAS 2289-75-0
Catalog: |
BB017798 |
Product Name: |
2-Amino-4,5-dimethylthiazole |
CAS: |
2289-75-0 |
Synonyms: |
4,5-dimethyl-2-thiazolamine; 4,5-dimethyl-1,3-thiazol-2-amine |
IUPAC Name: | 4,5-dimethyl-1,3-thiazol-2-amine |
Description: | 2-Amino-4,5-dimethylthiazole (CAS# 2289-75-0) is a useful research chemical. |
Molecular Weight: | 128.20 |
Molecular Formula: | C5H8N2S |
Canonical SMILES: | CC1=C(SC(=N1)N)C |
InChI: | InChI=1S/C5H8N2S/c1-3-4(2)8-5(6)7-3/h1-2H3,(H2,6,7) |
InChI Key: | XMXLBDNVSIHRRA-UHFFFAOYSA-N |
Boiling Point: | 256.1 °C at 760 mmHg |
Density: | 1.198 g/cm3 |
MDL: | MFCD00462425 |
LogP: | 1.92330 |
GHS Hazard Statement: | H302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P301+P312, P330, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2015002894-A1 | Purinone compounds as kinase inhibitors | 20130702 |
WO-2014202184-A1 | Conjugated polymers | 20130621 |
US-2016137637-A1 | 2,3-dihydrobenzofuran-5yl compounds as dyrk kinase inhibitors | 20130618 |
WO-2014202638-A1 | 2,3-dihydrobenzofuran-5-yl compounds as dyrk kinase inhibitors | 20130618 |
US-2015152108-A1 | Substituted bridged urea analogs as sirtuin modulators | 20130513 |
PMID | Publication Date | Title | Journal |
18477512 | 20080601 | Design, synthesis, and evaluation of potential inhibitors of nitric oxide synthase | Bioorganic & medicinal chemistry |
16839131 | 20060721 | Assessing the nitrogen and carbon nucleophilicities of 2-aminothiazoles through coupling with superelectrophilic 4,6-dinitrobenzofuroxan | The Journal of organic chemistry |
Complexity: | 86.5 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 128.04081944 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 128.04081944 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 67.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS