2-Amino-4-(3-nitrophenyl)thiazole - CAS 57493-24-0
Catalog: |
BB029721 |
Product Name: |
2-Amino-4-(3-nitrophenyl)thiazole |
CAS: |
57493-24-0 |
Synonyms: |
4-(3-nitrophenyl)-2-thiazolamine; 4-(3-nitrophenyl)-1,3-thiazol-2-amine |
IUPAC Name: | 4-(3-nitrophenyl)-1,3-thiazol-2-amine |
Description: | 2-Amino-4-(3-nitrophenyl)thiazole (CAS# 57493-24-0) is a useful research chemical. |
Molecular Weight: | 221.24 |
Molecular Formula: | C9H7N3O2S |
Canonical SMILES: | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CSC(=N2)N |
InChI: | InChI=1S/C9H7N3O2S/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14/h1-5H,(H2,10,11) |
InChI Key: | CHBDOPARQRNCDM-UHFFFAOYSA-N |
Boiling Point: | 447.2 °C at 760 mmHg |
Density: | 1.459 g/cm3 |
MDL: | MFCD00022455 |
LogP: | 3.40490 |
GHS Hazard Statement: | H302 (97.5%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-109456280-B | 4-phenylthiazole-2-amine derivative containing urea structure and preparation method and application thereof | 20181224 |
WO-2019234237-A1 | Heterocyclic compounds as class ii phosphoinositide 3-kinase inhibitors | 20180607 |
AU-2019281015-A1 | Heterocyclic compounds as class II phosphoinositide 3-kinase inhibitors | 20180607 |
EP-3802530-A1 | Heterocyclic compounds as class ii phosphoinositide 3-kinase inhibitors | 20180607 |
CN-107501204-B | Method for synthesizing 1, 3-substituted thiazole ring compound from styrene compound | 20170901 |
Complexity: | 246 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 221.02589765 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 221.02589765 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 113 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS