2-Amino-3-nitrobenzyl Alcohol - CAS 139743-08-1
Catalog: |
BB008980 |
Product Name: |
2-Amino-3-nitrobenzyl Alcohol |
CAS: |
139743-08-1 |
Synonyms: |
(2-amino-3-nitrophenyl)methanol; (2-amino-3-nitrophenyl)methanol |
IUPAC Name: | (2-amino-3-nitrophenyl)methanol |
Description: | 2-Amino-3-nitrobenzyl Alcohol (CAS# 139743-08-1) is a useful research chemical. |
Molecular Weight: | 168.15 |
Molecular Formula: | C7H8N2O3 |
Canonical SMILES: | C1=CC(=C(C(=C1)[N+](=O)[O-])N)CO |
InChI: | InChI=1S/C7H8N2O3/c8-7-5(4-10)2-1-3-6(7)9(11)12/h1-3,10H,4,8H2 |
InChI Key: | KFDXMUKYIMSGDC-UHFFFAOYSA-N |
MDL: | MFCD09880172 |
LogP: | 1.77370 |
Publication Number | Title | Priority Date |
JP-2010120852-A | Novel diamide derivatives | 20070309 |
TW-200843752-A | Novel diamide derivative | 20070309 |
AU-2005264996-A1 | Gonadotropin releasing hormone receptor antagonists | 20040617 |
CA-2570968-A1 | Gonadotropin releasing hormone receptor antagonists | 20040617 |
EP-1758895-A1 | Gonadotropin releasing hormone receptor antagonists | 20040617 |
PMID | Publication Date | Title | Journal |
22032295 | 20111121 | Organometallic 3-(1H-benzimidazol-2-yl)-1H-pyrazolo[3,4-b]pyridines as potential anticancer agents | Inorganic chemistry |
16315327 | 20060205 | Oxidation of aminonitrotoluenes by 2,4-DNT dioxygenase of Burkholderia sp. strain DNT | Biotechnology and bioengineering |
Complexity: | 169 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 168.05349212 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 168.05349212 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 92.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS