2-Amino-3-methylnaphthalene-1,4-dione - CAS 7427-09-0
Catalog: |
BB035043 |
Product Name: |
2-Amino-3-methylnaphthalene-1,4-dione |
CAS: |
7427-09-0 |
Synonyms: |
2-amino-3-methylnaphthalene-1,4-dione; 2-amino-3-methylnaphthalene-1,4-dione |
IUPAC Name: | 2-amino-3-methylnaphthalene-1,4-dione |
Description: | 2-Amino-3-methylnaphthalene-1,4-dione (CAS# 7427-09-0 ) is a useful research chemical. |
Molecular Weight: | 187.19 |
Molecular Formula: | C11H9NO2 |
Canonical SMILES: | CC1=C(C(=O)C2=CC=CC=C2C1=O)N |
InChI: | InChI=1S/C11H9NO2/c1-6-9(12)11(14)8-5-3-2-4-7(8)10(6)13/h2-5H,12H2,1H3 |
InChI Key: | MRYHMFJDZYADEB-UHFFFAOYSA-N |
LogP: | 1.99860 |
Publication Number | Title | Priority Date |
TW-202024105-A | Phosphorus-containing curing agent, epoxy resin composition containing the phosphorus-containing curing agent and epoxy resin, and cured product thereof | 20180927 |
AU-2014278318-A1 | Inhibitors of the MITF molecular pathway | 20130610 |
EP-3007688-A2 | Inhibitors of the mitf molecular pathway | 20130610 |
US-2016130222-A1 | Inhibitors of the mitf molecular pathway | 20130610 |
US-2017334842-A1 | Inhibitors of the mitf molecular pathway | 20130610 |
Complexity: | 330 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 187.06332853 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 187.06332853 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 60.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS