2-Amino-1-morpholinoethanone - CAS 56414-96-1
Catalog: |
BB029354 |
Product Name: |
2-Amino-1-morpholinoethanone |
CAS: |
56414-96-1 |
Synonyms: |
2-amino-1-(4-morpholinyl)ethanone; 2-amino-1-morpholin-4-ylethanone |
IUPAC Name: | 2-amino-1-morpholin-4-ylethanone |
Description: | 2-Amino-1-morpholinoethanone (CAS# 56414-96-1) is a reactant used in the synthesis of novel diamide derivatives as antiglycemic agents. |
Molecular Weight: | 144.17 |
Molecular Formula: | C6H12N2O2 |
Canonical SMILES: | C1COCCN1C(=O)CN |
InChI: | InChI=1S/C6H12N2O2/c7-5-6(9)8-1-3-10-4-2-8/h1-5,7H2 |
InChI Key: | IKNPVOCSVYGOLC-UHFFFAOYSA-N |
LogP: | -0.55790 |
Publication Number | Title | Priority Date |
WO-2021212039-A1 | Inhibitors of cysteine proteases and methods of use thereof | 20200417 |
WO-2020126953-A1 | Novel imidazopyrazine derivatives as antibacterials | 20181217 |
CA-3066859-A1 | Substituted pyrrolopyridine-derivatives | 20170613 |
EP-3638669-A1 | Substituted pyrrolopyridine-derivatives | 20170613 |
WO-2018228920-A1 | Substituted pyrrolopyridine-derivatives | 20170613 |
Complexity: | 121 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 144.08987763 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 144.08987763 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS