2,8-Dimethylnonane-4,6-dione - CAS 7307-08-6
Catalog: |
BB034755 |
Product Name: |
2,8-Dimethylnonane-4,6-dione |
CAS: |
7307-08-6 |
Synonyms: |
2,8-dimethylnonane-4,6-dione; 2,8-dimethylnonane-4,6-dione |
IUPAC Name: | 2,8-dimethylnonane-4,6-dione |
Description: | 2,8-Dimethylnonane-4,6-dione (CAS# 7307-08-6 ) is a useful research chemical. |
Molecular Weight: | 184.28 |
Molecular Formula: | C11H20O2 |
Canonical SMILES: | CC(C)CC(=O)CC(=O)CC(C)C |
InChI: | InChI=1S/C11H20O2/c1-8(2)5-10(12)7-11(13)6-9(3)4/h8-9H,5-7H2,1-4H3 |
InChI Key: | GJMUCDMIIVSROW-UHFFFAOYSA-N |
Appearance: | Colorless to light yellow liquid |
LogP: | 2.60690 |
Publication Number | Title | Priority Date |
CN-112094301-A | Isoquinoline metal complex and preparation method and application thereof | 20200923 |
US-2021130383-A1 | Organic electroluminescent material and device | 20191105 |
CN-111116673-A | Red phosphorescent compound and organic electroluminescent device using the same | 20191020 |
JP-2021020888-A | Metal complex and light emitting device containing it | 20190726 |
WO-2021019884-A1 | Metal complex and light-emitting element containing same | 20190726 |
Complexity: | 161 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 184.146329876 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 184.146329876 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 34.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS