2,7-Di-tert-butylfluorene - CAS 58775-05-6
Catalog: |
BB030160 |
Product Name: |
2,7-Di-tert-butylfluorene |
CAS: |
58775-05-6 |
Synonyms: |
2,7-ditert-butyl-9H-fluorene |
IUPAC Name: | 2,7-ditert-butyl-9H-fluorene |
Description: | 2,7-Di-tert-butylfluorene (CAS# 58775-05-6) is a useful research chemical. |
Molecular Weight: | 278.43 |
Molecular Formula: | C21H26 |
Canonical SMILES: | CC(C)(C)C1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)C(C)(C)C |
InChI: | InChI=1S/C21H26/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18/h7-10,12-13H,11H2,1-6H3 |
InChI Key: | DFZYPLLGAQIQTD-UHFFFAOYSA-N |
Boiling Point: | 372.4 ℃ at 760 mmHg |
Melting Point: | 121-124 ℃ |
Purity: | 98 % |
Density: | 0.988 g/cm3 |
Storage: | Sealed in dry. Room temperature. |
MDL: | MFCD03093998 |
LogP: | 5.85280 |
Precautionary Statement: | P280-P305P351P338 |
Publication Number | Title | Priority Date |
CN-112239474-A | Silicon-based bridged polysubstituted indene-fluorene zirconium and hafnium complex and application thereof in high-temperature polymerization of olefin | 20200922 |
CN-111499557-A | Organic main body material and electroluminescent device | 20200423 |
US-2021261697-A1 | Metallocene catalysts for polyethylene | 20200221 |
WO-2021168023-A1 | Metallocene catalysts for polyethylene | 20200221 |
WO-2021156598-A1 | Tracers and method of marking liquids | 20200203 |
PMID | Publication Date | Title | Journal |
20148219 | 20100227 | Reactions of germenes with various naphthoquinones controlled by substituent effects | Dalton transactions (Cambridge, England : 2003) |
19235967 | 20090302 | Novel types of tetra-, hexa-, octa-, and dodecanuclear silver clusters containing (2,7-Di-tert-butylfluoren-9-ylidene)methanedithiolate | Inorganic chemistry |
18855385 | 20081117 | Dinuclear copper(I) and copper(I)/silver(I) complexes with condensed dithiolato ligands | Inorganic chemistry |
15252531 | 20040221 | Synthesis, structure and reactivity of ferrio-chloro-phosphanes, -arsanes and -stibanes [(CO)2(eta5-C5Me5)FePn(Cl)R] (Pn = P, As, Sb); R = tetramethylcyclopentadienyl, 2,7-di-tert-butylfluorenyl, 2,7-di-tert-butyl-9-trimethylsilylfluorenyl) as precursor to novel metallo-phosphaalkenes, -arsaalkenes, and -stibaalkenes | Dalton transactions (Cambridge, England : 2003) |
Complexity: | 331 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 278.203450829 |
Formal Charge: | 0 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 278.203450829 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 6.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Arenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS