2-(6-Methoxy-4-methyl-2-oxo-1-quinolyl)acetaldehyde - CAS 917835-19-9
Catalog: |
BB040351 |
Product Name: |
2-(6-Methoxy-4-methyl-2-oxo-1-quinolyl)acetaldehyde |
CAS: |
917835-19-9 |
Synonyms: |
2-(6-methoxy-4-methyl-2-oxo-1-quinolinyl)acetaldehyde; 2-(6-methoxy-4-methyl-2-oxoquinolin-1-yl)acetaldehyde |
IUPAC Name: | 2-(6-methoxy-4-methyl-2-oxoquinolin-1-yl)acetaldehyde |
Description: | 2-(6-Methoxy-4-methyl-2-oxo-1-quinolyl)acetaldehyde (CAS# 917835-19-9 ) is a useful research chemical. |
Molecular Weight: | 231.25 |
Molecular Formula: | C13H13NO3 |
Canonical SMILES: | CC1=CC(=O)N(C2=C1C=C(C=C2)OC)CC=O |
InChI: | InChI=1S/C13H13NO3/c1-9-7-13(16)14(5-6-15)12-4-3-10(17-2)8-11(9)12/h3-4,6-8H,5H2,1-2H3 |
InChI Key: | HFVDEZUOANNUGK-UHFFFAOYSA-N |
LogP: | 1.51740 |
Publication Number | Title | Priority Date |
EP-1900732-A1 | Novel nitrogenated heterocyclic compound and salt thereof | 20050624 |
EP-2468743-A1 | Nitrogen-containing bicyclic compounds useful as antibacterial agents | 20050624 |
JP-5398984-B2 | Novel nitrogen-containing heterocyclic compounds and salts thereof | 20050624 |
JP-WO2006137485-A1 | Novel nitrogen-containing heterocyclic compounds and salts thereof | 20050624 |
US-2010168418-A1 | Novel nitrogenated heterocyclic compound and salt thereof | 20050624 |
Complexity: | 351 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.08954328 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.08954328 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 46.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS