2,6-Dimethylphenyl isocyanide - CAS 2769-71-3
Catalog: |
BB019650 |
Product Name: |
2,6-Dimethylphenyl isocyanide |
CAS: |
2769-71-3 |
Synonyms: |
2-isocyano-1,3-dimethylbenzene |
IUPAC Name: | 2-isocyano-1,3-dimethylbenzene |
Description: | 2,6-Dimethylphenyl isocyanide (CAS# 2769-71-3) is a useful research chemical. |
Molecular Weight: | 131.17 |
Molecular Formula: | C9H9N |
Canonical SMILES: | CC1=C(C(=CC=C1)C)[N+]#[C-] |
InChI: | InChI=1S/C9H9N/c1-7-5-4-6-8(2)9(7)10-3/h4-6H,1-2H3 |
InChI Key: | DNJLFZHMJDSJFN-UHFFFAOYSA-N |
Appearance: | Solid |
LogP: | 2.08490 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P312, P322, P330, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112778324-A | Polysubstituted difuran cycloheptatrienamine derivative and preparation method thereof | 20210127 |
CN-110698500-A | Gold alkynyl complex for silver ion sensing identification and preparation method and application thereof | 20191030 |
JP-2021042177-A | Method for producing organosilicon compound using novel isocyanide compound, formamide compound and isocyanide compound | 20190913 |
JP-2020169147-A | How to make alkapoliene | 20190404 |
JP-2020169148-A | How to make alkapoliene | 20190404 |
PMID | Publication Date | Title | Journal |
23025850 | 20121015 | Interplay of metallophilic interactions, π-π stacking, and ligand substituent effects in the structures and luminescence properties of neutral Pt(II) and Pd(II) aryl isocyanide complexes | Inorganic chemistry |
22708892 | 20120702 | Oxygen reduction reactions of monometallic rhodium hydride complexes | Inorganic chemistry |
22587409 | 20120530 | Exceptionally long-lived luminescence from [Cu(I)(isocyanide)2(phen)]+ complexes in nanoporous crystals enables remarkable oxygen gas sensing | Journal of the American Chemical Society |
22396950 | 20120421 | Organic isocyanide-adsorbed gold nanostructure: a SERS sensory device for indirect peak-shift detection of volatile organic compounds | The Analyst |
22296217 | 20120220 | Synthesis and calorimetric, spectroscopic, and structural characterization of isocyanide complexes of trialkylaluminum and tri-tert-butylgallium | Inorganic chemistry |
Complexity: | 143 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 131.073499291 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 131.073499291 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 4.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS