2,6-Dimethoxypyridine-3-methanol - CAS 562840-47-5
Catalog: |
BB029317 |
Product Name: |
2,6-Dimethoxypyridine-3-methanol |
CAS: |
562840-47-5 |
Synonyms: |
(2,6-dimethoxypyridin-3-yl)methanol |
IUPAC Name: | (2,6-dimethoxypyridin-3-yl)methanol |
Description: | 2,6-Dimethoxypyridine-3-methanol (CAS# 562840-47-5) is a useful research chemical. |
Molecular Weight: | 169.18 |
Molecular Formula: | C8H11NO3 |
Canonical SMILES: | COC1=NC(=C(C=C1)CO)OC |
InChI: | InChI=1S/C8H11NO3/c1-11-7-4-3-6(5-10)8(9-7)12-2/h3-4,10H,5H2,1-2H3 |
InChI Key: | XACFTRAAEZWJMN-UHFFFAOYSA-N |
Purity: | 95 % |
Appearance: | White to tan crystalline powder |
LogP: | 0.59110 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-1460062-A1 | Nitrogenous cyclic ketone derivative, process for producing the same, and use | 20011228 |
JP-2003252853-A | Nitrogen-containing cyclic ketone derivatives, their production and use | 20011228 |
US-2005038072-A1 | Nitrogeneous cyclic ketone derivative, process for producing the same, and use | 20011228 |
Complexity: | 132 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 169.07389321 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 169.07389321 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 51.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS