2,6-Dimethoxypyridine-3-carboxaldehyde - CAS 58819-72-0
Catalog: |
BB030171 |
Product Name: |
2,6-Dimethoxypyridine-3-carboxaldehyde |
CAS: |
58819-72-0 |
Synonyms: |
2,6-dimethoxypyridine-3-carbaldehyde |
IUPAC Name: | 2,6-dimethoxypyridine-3-carbaldehyde |
Description: | 2,6-Dimethoxypyridine-3-carboxaldehyde (CAS# 58819-72-0) is a useful research chemical. |
Molecular Weight: | 167.16 |
Molecular Formula: | C8H9NO3 |
Canonical SMILES: | COC1=NC(=C(C=C1)C=O)OC |
InChI: | InChI=1S/C8H9NO3/c1-11-7-4-3-6(5-10)8(9-7)12-2/h3-5H,1-2H3 |
InChI Key: | UWHJWEBMUYYQKM-UHFFFAOYSA-N |
Boiling Point: | 277.3 ℃ at 760 mmHg |
Purity: | 98 % |
Density: | 1.174 g/cm3 |
MDL: | MFCD08064048 |
LogP: | 0.91130 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P272, P280, P301+P312, P302+P352, P305+P351+P338, P310, P321, P330, P333+P313, P363, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021057190-A1 | Quinoline compounds, preparation method therefor and use thereof | 20190929 |
US-10195189-B2 | 2-phenethenyltetrahydro isoquinolines useful as anti-HIV compounds | 20141215 |
US-2016168100-A1 | Anti-hiv compounds | 20141215 |
US-2017368051-A1 | 2-phenethenyltetrahydro isoquinolines useful as anti-hiv compounds | 20141215 |
US-2019111044-A1 | 2-phenethenyltetrahydro isoquinolines useful as anti-hiv compounds | 20141215 |
Complexity: | 151 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 167.058243149 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 167.058243149 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 48.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS