2,6-Dimethoxybenzonitrile - CAS 16932-49-3
Catalog: |
BB012538 |
Product Name: |
2,6-Dimethoxybenzonitrile |
CAS: |
16932-49-3 |
Synonyms: |
2,6-dimethoxybenzonitrile; 2,6-dimethoxybenzonitrile |
IUPAC Name: | 2,6-dimethoxybenzonitrile |
Description: | 2,6-Dimethoxybenzonitrile (CAS# 16932-49-3) is a useful research chemical. |
Molecular Weight: | 163.17 |
Molecular Formula: | C9H9NO2 |
Canonical SMILES: | COC1=C(C(=CC=C1)OC)C#N |
InChI: | InChI=1S/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
InChI Key: | XHAHKSSLDJIEDH-UHFFFAOYSA-N |
Boiling Point: | 310 ℃ |
Density: | 1.12 g/cm3 |
MDL: | MFCD00001788 |
LogP: | 1.57548 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P312, P322, P330, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
TW-201922736-A | Epoxyoxycyclobutane compound, synthesis method thereof and utilization of the compound | 20171023 |
TW-201730311-A | Follower | 20150930 |
TW-201704415-A | Antistatic agent for adhesives | 20150728 |
US-9139696-B1 | Aromatic diamines containing three ether-linked-benzonitrile moieties, polymers thereof, and methods of making the same | 20140328 |
JP-2015107948-A | Process for producing aromatic thiazole compound | 20131206 |
PMID | Publication Date | Title | Journal |
15606181 | 20041227 | Photochemical expulsion of the neutral monodentate ligand L in Ru(terpy*)(diimine)(L)2+: a dramatic effect of the steric properties of the spectator diimine ligand | Inorganic chemistry |
Complexity: | 172 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 163.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 163.063328530 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS