2,6-Difluoropyridin-3-amine - CAS 108118-69-0
Catalog: |
BB002171 |
Product Name: |
2,6-Difluoropyridin-3-amine |
CAS: |
108118-69-0 |
Synonyms: |
2,6-difluoro-3-pyridinamine; 2,6-difluoropyridin-3-amine |
IUPAC Name: | 2,6-difluoropyridin-3-amine |
Description: | 2,6-Difluoropyridin-3-amine (CAS# 108118-69-0) is a useful research chemical. |
Molecular Weight: | 130.10 |
Molecular Formula: | C5H4F2N2 |
Canonical SMILES: | C1=CC(=NC(=C1N)F)F |
InChI: | InChI=1S/C5H4F2N2/c6-4-2-1-3(8)5(7)9-4/h1-2H,8H2 |
InChI Key: | TVWPHKCZBQOPBF-UHFFFAOYSA-N |
Appearance: | Black powder |
LogP: | 1.52320 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
US-2020171020-A1 | Substituted 6-azabenzimidazole compounds | 20181031 |
WO-2020092528-A1 | Substituted 6-azabenzimidazole compounds having hpk1 inhibitory activity | 20181031 |
TW-202031654-A | Substituted 6-azabenzimidazole compounds | 20181031 |
CN-112969505-A | Substituted 6-azabenzimidazole compounds having HPK1 inhibiting activity | 20181031 |
EP-3873608-A1 | Substituted 6-azabenzimidazole compounds having hpk1 inhibitory activity | 20181031 |
Complexity: | 99 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 130.03425446 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 130.03425446 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS