2,6-Difluoro-3-nitropyridine - CAS 58602-02-1
Catalog: |
BB030098 |
Product Name: |
2,6-Difluoro-3-nitropyridine |
CAS: |
58602-02-1 |
Synonyms: |
2,6-difluoro-3-nitropyridine; 2,6-difluoro-3-nitropyridine |
IUPAC Name: | 2,6-difluoro-3-nitropyridine |
Description: | 2,6-Difluoro-3-nitropyridine (CAS# 58602-02-1) is a useful research chemical. |
Molecular Weight: | 160.08 |
Molecular Formula: | C5H2F2N2O2 |
Canonical SMILES: | C1=CC(=NC(=C1[N+](=O)[O-])F)F |
InChI: | InChI=1S/C5H2F2N2O2/c6-4-2-1-3(9(10)11)5(7)8-4/h1-2H |
InChI Key: | GFDZKTFHLUFNPC-UHFFFAOYSA-N |
Boiling Point: | 259 °C at 760 mmHg |
Density: | 1.555 g/cm3 |
LogP: | 1.79120 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2181992-A1 | Polycyclic compound | 20070831 |
US-2009062529-A1 | Multi-cyclic compounds | 20070831 |
US-2011009619-A1 | Polycyclic compound | 20070831 |
US-2011065696-A1 | Imidazoyl pyridine compounds and salts thereof | 20070831 |
US-7935815-B2 | Imidazoyl pyridine compounds and salts thereof | 20070831 |
Complexity: | 161 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.00843363 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.00843363 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS