2,6-Dichloropyridine-4-carbonyl chloride - CAS 42521-08-4
Catalog: |
BB025148 |
Product Name: |
2,6-Dichloropyridine-4-carbonyl chloride |
CAS: |
42521-08-4 |
Synonyms: |
2,6-dichloropyridine-4-carbonyl chloride |
IUPAC Name: | 2,6-dichloropyridine-4-carbonyl chloride |
Description: | 2,6-Dichloropyridine-4-carbonyl chloride (CAS# 42521-08-4) is a useful research chemical. |
Molecular Weight: | 210.45 |
Molecular Formula: | C6H2Cl3NO |
Canonical SMILES: | C1=C(C=C(N=C1Cl)Cl)C(=O)Cl |
InChI: | InChI=1S/C6H2Cl3NO/c7-4-1-3(6(9)11)2-5(8)10-4/h1-2H |
InChI Key: | QLRUROKTVFUQIV-UHFFFAOYSA-N |
Boiling Point: | 243 °C |
Melting Point: | 25 °C |
Purity: | 98 % |
Density: | 1.537 g/cm3 |
Appearance: | Colorless to yellow liquid |
MDL: | MFCD00052639 |
LogP: | 2.76740 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P337+P313, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
JP-2020109058-A | Plant virus disease control agent containing isonicotinic acid compound | 20181229 |
WO-2020054531-A1 | Plant disease control agent | 20180914 |
TW-202021951-A | Plant disease control agent | 20180914 |
WO-2016010108-A1 | Nitrogen-containing heterocyclic derivatives and medicinal compositions comprising same | 20140718 |
WO-2012035055-A1 | Novel compounds | 20100917 |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 208.920197 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 208.920197 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS