2,6-Dichloropyridine-3-carbonitrile - CAS 40381-90-6
Catalog: |
BB024477 |
Product Name: |
2,6-Dichloropyridine-3-carbonitrile |
CAS: |
40381-90-6 |
Synonyms: |
2,6-dichloropyridine-3-carbonitrile |
IUPAC Name: | 2,6-dichloropyridine-3-carbonitrile |
Description: | 2,6-Dichloropyridine-3-carbonitrile (CAS# 40381-90-6) is a useful research chemical. |
Molecular Weight: | 173.00 |
Molecular Formula: | C6H2Cl2N2 |
Canonical SMILES: | C1=CC(=NC(=C1C#N)Cl)Cl |
InChI: | InChI=1S/C6H2Cl2N2/c7-5-2-1-4(3-9)6(8)10-5/h1-2H |
InChI Key: | LFCADBSUDWERJT-UHFFFAOYSA-N |
Boiling Point: | 286.002 °C at 760 mmHg |
Melting Point: | 121-124 °C |
Purity: | 98 % |
Density: | 1.5 g/cm3 |
MDL: | MFCD03411341 |
LogP: | 2.26008 |
GHS Hazard Statement: | H301 (99.24%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113004512-A | Polymer and preparation method and application thereof | 20191220 |
CN-112979655-A | Triazolopyridazine derivative, preparation method, pharmaceutical composition and application thereof | 20191216 |
WO-2021121294-A1 | Triazolopyridazine derivative, preparation method therefor, pharmaceutical composition thereof, and use thereof | 20191216 |
WO-2021081207-A1 | Glp-1r modulating compounds | 20191025 |
US-2021171499-A1 | Glp-1r modulating compounds | 20191025 |
Complexity: | 162 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 171.9595035 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 171.9595035 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 36.7 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS