2,6-Dichlorobenzotrifluoride - CAS 104359-35-5
Catalog: |
BB001384 |
Product Name: |
2,6-Dichlorobenzotrifluoride |
CAS: |
104359-35-5 |
Synonyms: |
1,3-dichloro-2-(trifluoromethyl)benzene; 1,3-dichloro-2-(trifluoromethyl)benzene |
IUPAC Name: | 1,3-dichloro-2-(trifluoromethyl)benzene |
Description: | 2,6-Dichlorobenzotrifluoride (CAS# 104359-35-5) is a useful research chemical. |
Molecular Weight: | 215.00 |
Molecular Formula: | C7H3Cl2F3 |
Canonical SMILES: | C1=CC(=C(C(=C1)Cl)C(F)(F)F)Cl |
InChI: | InChI=1S/C7H3Cl2F3/c8-4-2-1-3-5(9)6(4)7(10,11)12/h1-3H |
InChI Key: | MKSYCGMWKMMQPN-UHFFFAOYSA-N |
Boiling Point: | 202.1 °C at 760 mmHg |
Density: | 1.464 g/cm3 |
Storage: | Sealed in dry, 2-8 °C |
MDL: | MFCD11035870 |
LogP: | 4.01220 |
Publication Number | Title | Priority Date |
WO-2020189540-A1 | Method for preparing aromatic amino acid derivative | 20190315 |
JP-2019157008-A | Disubstituted halogenated polyethers and polymer electrolytes containing the same | 20180314 |
JP-2018131437-A | Method for producing stereoselective disubstituted halogenated epoxides | 20170214 |
WO-2018151019-A1 | Stereoselective production method for disubstituted halogenated epoxide | 20170214 |
CN-108349885-B | Method for producing 2-alkyl-4-trifluoromethyl-3-alkylsulfonylbenzoic acids by chemoselective thioether oxidation | 20151130 |
Complexity: | 147 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.95639 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.95639 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS