2,6-Dichlorobenzenesulfonyl chloride - CAS 6579-54-0
Catalog: |
BB032829 |
Product Name: |
2,6-Dichlorobenzenesulfonyl chloride |
CAS: |
6579-54-0 |
Synonyms: |
2,6-dichlorobenzenesulfonyl chloride |
IUPAC Name: | 2,6-dichlorobenzenesulfonyl chloride |
Description: | 2,6-Dichlorobenzenesulfonyl chloride (CAS# 6579-54-0) is a useful research chemical. |
Molecular Weight: | 245.51 |
Molecular Formula: | C6H3Cl3O2S |
Canonical SMILES: | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl |
InChI: | InChI=1S/C6H3Cl3O2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H |
InChI Key: | WGGKQIKICKLWGN-UHFFFAOYSA-N |
Boiling Point: | 326 ℃ at 760 mmHg |
Melting Point: | 52-54 ℃ |
Purity: | 95 % |
Density: | 1.636 g/cm3 |
Appearance: | White crystalline |
MDL: | MFCD00052311 |
LogP: | 4.00170 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113121467-A | Benzothiazole derivative and medical application thereof | 20210420 |
CN-112552309-A | Psoralen benzene sulfonate derivative and application thereof | 20201217 |
WO-2021102314-A1 | Trpv4 receptor ligands | 20191121 |
WO-2021065450-A1 | Active light sensitive or radiation sensitive resin composition, active light sensitive or radiation sensitive film, pattern forming method, and method for producing electronic device | 20190930 |
CN-109761980-B | 3-aminosulfonylamino-substituted rutaecarpine derivative and preparation method and application thereof | 20190219 |
Complexity: | 236 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 243.891934 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 243.891934 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 42.5 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS