2,6-Dichloro-3-methylphenylboronic Acid - CAS 851756-54-2
Catalog: |
BB037522 |
Product Name: |
2,6-Dichloro-3-methylphenylboronic Acid |
CAS: |
851756-54-2 |
Synonyms: |
(2,6-dichloro-3-methylphenyl)boronic acid; (2,6-dichloro-3-methylphenyl)boronic acid |
IUPAC Name: | (2,6-dichloro-3-methylphenyl)boronic acid |
Description: | 2,6-Dichloro-3-methylphenylboronic Acid (CAS# 851756-54-2) is a useful research chemical. |
Molecular Weight: | 204.85 |
Molecular Formula: | C7H7Cl2O2B |
Canonical SMILES: | B(C1=C(C=CC(=C1Cl)C)Cl)(O)O |
InChI: | InChI=1S/C7H7BCl2O2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3,11-12H,1H3 |
InChI Key: | QRWVEDFFDGYSPO-UHFFFAOYSA-N |
Boiling Point: | 363.6 °C at 760 mmHg |
Density: | 1.4 g/cm3 |
MDL: | MFCD09800875 |
LogP: | 0.98160 |
Publication Number | Title | Priority Date |
CN-106636043-A | Preparation method of protease | 20161227 |
CN-106636043-B | Method for producing protease | 20161227 |
CA-2984290-A1 | Benzimidazolone and benzothiazolone compounds and their use as ampa receptor modulators | 20150429 |
EP-3288936-A1 | Benzimidazolone and benzothiazolone compounds and their use as ampa receptor modulators | 20150429 |
EP-3288936-B1 | Benzimidazolone and benzothiazolone compounds and their use as ampa receptor modulators | 20150429 |
Complexity: | 156 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 203.991615 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 203.991615 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 40.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Boronic Acids and Esters
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS