2-(5-Methyl-2-thienyl)ethanamine - CAS 30433-92-2
Catalog: |
BB020593 |
Product Name: |
2-(5-Methyl-2-thienyl)ethanamine |
CAS: |
30433-92-2 |
Synonyms: |
2-(5-methyl-2-thiophenyl)ethanamine; 2-(5-methylthiophen-2-yl)ethanamine |
IUPAC Name: | 2-(5-methylthiophen-2-yl)ethanamine |
Description: | 2-(5-Methyl-2-thienyl)ethanamine (CAS# 30433-92-2) is a useful research chemical. |
Molecular Weight: | 141.23 |
Molecular Formula: | C7H11NS |
Canonical SMILES: | CC1=CC=C(S1)CCN |
InChI: | InChI=1S/C7H11NS/c1-6-2-3-7(9-6)4-5-8/h2-3H,4-5,8H2,1H3 |
InChI Key: | VAYWLNRNWZOIAG-UHFFFAOYSA-N |
Boiling Point: | 216.593 °C at 760 mmHg |
Density: | 1.073 g/cm3 |
MDL: | MFCD08059759 |
LogP: | 2.25800 |
Publication Number | Title | Priority Date |
TW-201823261-A | Organometallic complex and organic light emitting diode comprising same | 20161216 |
TW-I594999-B | Organometallic complex and organic light emitting diode comprising same | 20161216 |
US-2018175309-A1 | Organometallic compound and organic light-emitting device employing the same | 20161216 |
CN-108203451-B | Organometallic complex and organic light emitting diode including the same | 20161216 |
CN-107303298-B | Pharmaceutical application of benzo [ g ] heteroaryl [ a, g ] quinolizine compound and preparation method thereof | 20160421 |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 141.06122053 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 141.06122053 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 54.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS