2,5-Diiodo-4-methylimidazole - CAS 149510-85-0
Catalog: |
BB010417 |
Product Name: |
2,5-Diiodo-4-methylimidazole |
CAS: |
149510-85-0 |
Synonyms: |
2,4-diiodo-5-methyl-1H-imidazole; 2,4-diiodo-5-methyl-1H-imidazole |
IUPAC Name: | 2,4-diiodo-5-methyl-1H-imidazole |
Description: | 2,5-Diiodo-4-methylimidazole (CAS# 149510-85-0) is a useful research chemical. |
Molecular Weight: | 333.90 |
Molecular Formula: | C4H4I2N2 |
Canonical SMILES: | CC1=C(N=C(N1)I)I |
InChI: | InChI=1S/C4H4I2N2/c1-2-3(5)8-4(6)7-2/h1H3,(H,7,8) |
InChI Key: | GPBIXFAUPJOCRS-UHFFFAOYSA-N |
Boiling Point: | 387 ℃ at 760 mmHg |
Density: | 2.75 g/cm3 |
LogP: | 1.92730 |
Publication Number | Title | Priority Date |
AU-2015357167-B2 | 6,7-dihydropyrazolo(1,5-alpha)pyrazin-4(5H)-one compounds and their use as negative allosteric modulators of mGluR2 receptors | 20141203 |
CN-107001375-B | 6, 7-dihydropyrazolo [1,5-a ] pyrazin-4 (5H) -one compounds and their use as negative allosteric modulators of MGLUR2 receptors | 20141203 |
EP-3227295-A1 | 6,7-dihydropyrazolo[1,5- ]pyrazin-4(5h)-one compounds and their use as negative allosteric modulators of mglur2 receptors | 20141203 |
EP-3227295-B1 | 6,7-dihydropyrazolo[1,5- ]pyrazin-4(5h)-one compounds and their use as negative allosteric modulators of mglu2 receptors | 20141203 |
ES-2727379-T3 | 6,7-dihydropyrazolo [1,5-a] pyrazin-4 (5H) -one compounds and their use as negative allosteric modulators of mGlu2 receptors | 20141203 |
Complexity: | 88.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 333.84639 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 333.84639 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS