2,5-Difluoro-4-methoxybenzaldehyde - CAS 879093-08-0
Catalog: |
BB038674 |
Product Name: |
2,5-Difluoro-4-methoxybenzaldehyde |
CAS: |
879093-08-0 |
Synonyms: |
2,5-difluoro-4-methoxybenzaldehyde; 2,5-difluoro-4-methoxybenzaldehyde |
IUPAC Name: | 2,5-difluoro-4-methoxybenzaldehyde |
Description: | 2,5-Difluoro-4-methoxybenzaldehyde (CAS# 879093-08-0) is a useful research chemical. |
Molecular Weight: | 172.13 |
Molecular Formula: | C8H6F2O2 |
Canonical SMILES: | COC1=C(C=C(C(=C1)F)C=O)F |
InChI: | InChI=1S/C8H6F2O2/c1-12-8-3-6(9)5(4-11)2-7(8)10/h2-4H,1H3 |
InChI Key: | DCGKDDVUUMOTDH-UHFFFAOYSA-N |
Boiling Point: | 232.8 °C at 760 mmHg |
Density: | 1.289 g/cm3 |
MDL: | MFCD06246882 |
LogP: | 1.78590 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112574176-A | Heteroaryl compound and application thereof | 20190927 |
WO-2021057696-A1 | Heteroaryl compound and application thereof | 20190927 |
WO-2019128963-A1 | Anti-pulmonary tuberculosis nitroimidazole derivative | 20171226 |
AU-2018340397-A1 | Inhibitors of glutaminyl cyclase | 20170929 |
AU-2018340397-B2 | Inhibitors of glutaminyl cyclase | 20170929 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 172.03358575 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 172.03358575 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS