2,5-Dichlorobenzothiazole - CAS 2941-48-2
Catalog: |
BB020184 |
Product Name: |
2,5-Dichlorobenzothiazole |
CAS: |
2941-48-2 |
Synonyms: |
2,5-dichloro-1,3-benzothiazole; 2,5-dichloro-1,3-benzothiazole |
IUPAC Name: | 2,5-dichloro-1,3-benzothiazole |
Description: | 2,5-Dichlorobenzothiazole (CAS# 2941-48-2) is a useful research chemical. |
Molecular Weight: | 204.08 |
Molecular Formula: | C7H3Cl2NS |
Canonical SMILES: | C1=CC2=C(C=C1Cl)N=C(S2)Cl |
InChI: | InChI=1S/C7H3Cl2NS/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3H |
InChI Key: | LHUHAARPMJISMM-UHFFFAOYSA-N |
Boiling Point: | 286.775 °C at 760 mmHg |
Density: | 1.568 g/cm3 |
MDL: | MFCD00044024 |
LogP: | 3.60310 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021046194-A1 | Tryptoline-based benzothiazoles and their use as antibiotics and antibiotic resistance-modifying agents | 20190903 |
KR-20200038877-A | Organic light emitting device | 20181004 |
KR-20210036330-A | Organic light emitting device | 20181004 |
KR-20200035905-A | Novel compound and organic light emitting device comprising the same | 20180927 |
KR-102225488-B1 | Novel compound and organic light emitting device comprising the same | 20180927 |
Complexity: | 155 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 202.9363257 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 202.9363257 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzoxazole/Benzothiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS