2,5-Dibromothiophene-3-carboxaldehyde - CAS 1193-69-7
Catalog: |
BB004484 |
Product Name: |
2,5-Dibromothiophene-3-carboxaldehyde |
CAS: |
1193-69-7 |
Synonyms: |
2,5-dibromothiophene-3-carbaldehyde |
IUPAC Name: | 2,5-dibromothiophene-3-carbaldehyde |
Description: | 2,5-Dibromothiophene-3-carboxaldehyde (CAS# 1193-69-7) is a useful research chemical. |
Molecular Weight: | 269.94 |
Molecular Formula: | C5H2Br2OS |
Canonical SMILES: | C1=C(SC(=C1C=O)Br)Br |
InChI: | InChI=1S/C5H2Br2OS/c6-4-1-3(2-8)5(7)9-4/h1-2H |
InChI Key: | GBJBDOWMZMXKCD-UHFFFAOYSA-N |
LogP: | 3.08560 |
Publication Number | Title | Priority Date |
KR-102082222-B1 | polymer with partially polar functional group, method for producing the same and organic electronic device using the same | 20181023 |
WO-2019146773-A1 | Thiophene derivative and use thereof | 20180125 |
CN-111655685-A | Thiophene derivative and use thereof | 20180125 |
WO-2019112220-A1 | Polar functional group-partially introduced polymer, preparation method therefor, and organic electronic element containing same | 20171204 |
US-2020308342-A1 | Polar functional group-partially introduced polymer, preparation method therefor, and organic electronic element containing same | 20171204 |
Complexity: | 120 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 269.81726 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 267.81931 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 45.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Thiophenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS