2,5-Dibromopyridin-3-ol - CAS 857429-79-9
Catalog: |
BB037712 |
Product Name: |
2,5-Dibromopyridin-3-ol |
CAS: |
857429-79-9 |
Synonyms: |
2,5-dibromopyridin-3-ol |
IUPAC Name: | 2,5-dibromopyridin-3-ol |
Description: | 2,5-Dibromopyridin-3-ol (CAS# 857429-79-9) is a useful research chemical. |
Molecular Weight: | 252.89 |
Molecular Formula: | C5H3Br2NO |
Canonical SMILES: | C1=C(C(=NC=C1Br)Br)O |
InChI: | InChI=1S/C5H3Br2NO/c6-3-1-4(9)5(7)8-2-3/h1-2,9H |
InChI Key: | YWXPYIXETNBCFG-UHFFFAOYSA-N |
MDL: | MFCD09959722 |
LogP: | 2.31220 |
Publication Number | Title | Priority Date |
JP-2012123935-A | Ion-conducting polymer electrolyte with π stack and polymer electrolyte membrane, membrane electrode assembly and fuel cell using the same | 20101206 |
JP-5765760-B2 | Ion-conducting polymer electrolyte with π stack and polymer electrolyte membrane, membrane electrode assembly and fuel cell using the same | 20101206 |
EP-2311822-A1 | Gpr119 agonist | 20080801 |
US-2011137032-A1 | Gpr119 agonist | 20080801 |
US-2014018537-A1 | Gpr119 agonist | 20080801 |
Complexity: | 101 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 252.85609 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 250.85814 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 33.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS