2,5-Dibromobenzenesulfonamide - CAS 7467-11-0
Catalog: |
BB035132 |
Product Name: |
2,5-Dibromobenzenesulfonamide |
CAS: |
7467-11-0 |
Synonyms: |
2,5-dibromobenzenesulfonamide |
IUPAC Name: | 2,5-dibromobenzenesulfonamide |
Description: | 2,5-Dibromobenzenesulfonamide (CAS# 7467-11-0) is a useful research chemical. |
Molecular Weight: | 314.98 |
Molecular Formula: | C6H5Br2NO2S |
Canonical SMILES: | C1=CC(=C(C=C1Br)S(=O)(=O)N)Br |
InChI: | InChI=1S/C6H5Br2NO2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H,(H2,9,10,11) |
InChI Key: | INERZUPHFUUUPD-UHFFFAOYSA-N |
Boiling Point: | 424.1 ℃ at 760 mmHg |
Density: | 2.089 g/cm3 |
MDL: | MFCD00460436 |
LogP: | 3.64010 |
GHS Hazard Statement: | H302 (90.48%): Harmful if swallowed [Warning Acute toxicity, oral]; H312 (90.48%): Harmful in contact with skin [Warning Acute toxicity, dermal]; H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]; H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]; H332 (90.48%): Harmful if inhaled [Warning Acute toxicity, inhalation]; H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure; Respiratory tract irritation] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2015061518-A1 | Inhibitors of human immunodeficiency virus replication | 20131024 |
WO-2009081956-A1 | Method for producing conjugated aromatic compound | 20071221 |
US-2009264431-A1 | Novel cathepsin c inhibitors and their use | 20070820 |
WO-2009025160-A1 | Transition metal complex and process for producing conjugated aromatic compound with the transition metal complex | 20070820 |
WO-2009026197-A1 | Novel cathepsin c inhibitors and their use | 20070820 |
Complexity: | 249 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 314.83873 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 312.84077 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 68.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS