2,5-Dibromo-4-methylpyridine - CAS 3430-26-0
Catalog: |
BB022060 |
Product Name: |
2,5-Dibromo-4-methylpyridine |
CAS: |
3430-26-0 |
Synonyms: |
2,5-dibromo-4-methylpyridine |
IUPAC Name: | 2,5-dibromo-4-methylpyridine |
Description: | 2,5-Dibromo-4-methylpyridine (CAS# 3430-26-0) is a useful research chemical. |
Molecular Weight: | 250.92 |
Molecular Formula: | C6H5Br2N |
Canonical SMILES: | CC1=CC(=NC=C1Br)Br |
InChI: | InChI=1S/C6H5Br2N/c1-4-2-6(8)9-3-5(4)7/h2-3H,1H3 |
InChI Key: | WWJLJUAHQHXDGM-UHFFFAOYSA-N |
Boiling Point: | 262.8 ℃ at 760 mmHg |
Purity: | 98 % |
Density: | 1.911 g/cm3 |
MDL: | MFCD00234955 |
LogP: | 2.91500 |
GHS Hazard Statement: | H302 (89.36%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111961047-A | 6-ethoxy-3, 4-dihydro-2, 7-naphthyridine-1 (2H) -ketone and synthetic method thereof | 20200819 |
WO-2020231990-A1 | Fgfr inhibitors and methods of use thereof | 20190513 |
US-2020360353-A1 | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
WO-2020190754-A1 | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
TW-202102495-A | Macrocyclic azolopyridine derivatives as eed and prc2 modulators | 20190315 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 250.87682 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 248.87887 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS