2,5-Dibromo-4-methylimidazole - CAS 219814-29-6
Catalog: |
BB017237 |
Product Name: |
2,5-Dibromo-4-methylimidazole |
CAS: |
219814-29-6 |
Synonyms: |
2,4-dibromo-5-methyl-1H-imidazole; 2,4-dibromo-5-methyl-1H-imidazole |
IUPAC Name: | 2,4-dibromo-5-methyl-1H-imidazole |
Description: | 2,5-Dibromo-4-methylimidazole (CAS# 219814-29-6) is a useful research chemical. |
Molecular Weight: | 239.90 |
Molecular Formula: | C4H4Br2N2 |
Canonical SMILES: | CC1=C(N=C(N1)Br)Br |
InChI: | InChI=1S/C4H4Br2N2/c1-2-3(5)8-4(6)7-2/h1H3,(H,7,8) |
InChI Key: | RWHYUTSGEJYTMQ-UHFFFAOYSA-N |
Boiling Point: | 343.1 °C at 760 mmHg |
Density: | 2.188 g/cm3 |
MDL: | MFCD02179519 |
LogP: | 2.24310 |
Publication Number | Title | Priority Date |
CN-109643752-A | Flexible piezoelectric and ferroelectricity halogenated imidazole crystal | 20160412 |
EP-3443601-A1 | Flexible piezoelectric and ferroelectric haloimidazole crystals | 20160412 |
US-2019127331-A1 | Flexible piezoelectric and ferroelectric haloimidazole crystals | 20160412 |
WO-2017180721-A1 | Flexible piezoelectric and ferroelectric haloimidazole crystals | 20160412 |
US-11091443-B2 | Flexible piezoelectric and ferroelectric haloimidazole crystals | 20160412 |
Complexity: | 88.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 239.87207 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 237.87412 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 28.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS