2,5-Bis(benzyloxy)benzaldehyde - CAS 6109-54-2
Catalog: |
BB030944 |
Product Name: |
2,5-Bis(benzyloxy)benzaldehyde |
CAS: |
6109-54-2 |
Synonyms: |
2,5-bis(phenylmethoxy)benzaldehyde; 2,5-bis(phenylmethoxy)benzaldehyde |
IUPAC Name: | 2,5-bis(phenylmethoxy)benzaldehyde |
Description: | 2,5-Bis(benzyloxy)benzaldehyde (CAS# 6109-54-2) is a useful research chemical. |
Molecular Weight: | 318.37 |
Molecular Formula: | C21H18O3 |
Canonical SMILES: | C1=CC=C(C=C1)COC2=CC(=C(C=C2)OCC3=CC=CC=C3)C=O |
InChI: | InChI=1S/C21H18O3/c22-14-19-13-20(23-15-17-7-3-1-4-8-17)11-12-21(19)24-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
InChI Key: | MPNYEOHUDBSABW-UHFFFAOYSA-N |
MDL: | MFCD02380367 |
LogP: | 4.65710 |
Publication Number | Title | Priority Date |
JP-WO2019124092-A1 | Polymerizable compound, liquid crystal composition and liquid crystal display device using the same | 20171221 |
WO-2019124092-A1 | Polymerizable compound, and liquid crystal composition and liquid crystal display device using same | 20171221 |
CN-111344277-A | Polymerizable compound, and liquid crystal composition and liquid crystal display element using same | 20171221 |
JP-2020147576-A | Polymerizable compounds and liquid crystal compositions and liquid crystal display devices using them | 20171221 |
US-2021214299-A1 | Polymerizable compound, and liquid crystal composition and liquid crystal display device using the same | 20171221 |
Complexity: | 358 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 318.125594432 |
Formal Charge: | 0 |
Heavy Atom Count: | 24 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 318.125594432 |
Rotatable Bond Count: | 7 |
Topological Polar Surface Area: | 35.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS