2,5-Bis(4-fluorophenyl)thiophene-3-carbonitrile - CAS 908588-07-8
Catalog: |
BB039972 |
Product Name: |
2,5-Bis(4-fluorophenyl)thiophene-3-carbonitrile |
CAS: |
908588-07-8 |
Synonyms: |
2,5-bis(4-fluorophenyl)-3-thiophenecarbonitrile; 2,5-bis(4-fluorophenyl)thiophene-3-carbonitrile |
IUPAC Name: | 2,5-bis(4-fluorophenyl)thiophene-3-carbonitrile |
Description: | 2,5-Bis(4-fluorophenyl)thiophene-3-carbonitrile (CAS# 908588-07-8 ) is a useful research chemical. |
Molecular Weight: | 297.32 |
Molecular Formula: | C17H9F2NS |
Canonical SMILES: | C1=CC(=CC=C1C2=CC(=C(S2)C3=CC=C(C=C3)F)C#N)F |
InChI: | InChI=1S/C17H9F2NS/c18-14-5-1-11(2-6-14)16-9-13(10-20)17(21-16)12-3-7-15(19)8-4-12/h1-9H |
InChI Key: | DMELSFULBVEPQZ-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
CA-2833783-A1 | Design and synthesis of novel antimicrobials | 20060306 |
CA-2603534-A1 | Design and synthesis of novel antimicrobials | 20050304 |
CA-2603534-C | Design and synthesis of novel antimicrobials | 20050304 |
US-2010076028-A1 | Design and Synthesis of Novel Antimicrobials | 20050304 |
US-8835476-B2 | Synthesis of novel antimicrobials | 20050304 |
Complexity: | 391 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 297.04237679 |
Formal Charge: | 0 |
Heavy Atom Count: | 21 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 297.04237679 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 52 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS