2-(5,7-Difluoro-6-quinolyl)propanoic acid - CAS 1226776-94-8
Catalog: |
BB005452 |
Product Name: |
2-(5,7-Difluoro-6-quinolyl)propanoic acid |
CAS: |
1226776-94-8 |
Synonyms: |
2-(5,7-difluoro-6-quinolinyl)propanoic acid; 2-(5,7-difluoroquinolin-6-yl)propanoic acid |
IUPAC Name: | 2-(5,7-difluoroquinolin-6-yl)propanoic acid |
Description: | 2-(5,7-Difluoro-6-quinolyl)propanoic acid (CAS# 1226776-94-8 ) is a useful research chemical. |
Molecular Weight: | 237.20 |
Molecular Formula: | C12H9F2NO2 |
Canonical SMILES: | CC(C1=C(C=C2C(=C1F)C=CC=N2)F)C(=O)O |
InChI: | InChI=1S/C12H9F2NO2/c1-6(12(16)17)10-8(13)5-9-7(11(10)14)3-2-4-15-9/h2-6H,1H3,(H,16,17) |
InChI Key: | KGLPTUKGKASCTM-UHFFFAOYSA-N |
LogP: | 2.70110 |
Publication Number | Title | Priority Date |
EP-2673277-A1 | [1, 2, 4]triazolo [4, 3 -b]pyridazine compounds as inhibitors of the c-met tyrosine kinase | 20110210 |
US-2013324526-A1 | [1,2,4] triazolo [4,3-b] pyridazine compounds as inhibitors of the c-met tyrosine kinase | 20110210 |
WO-2012107500-A1 | [1, 2, 4] triazolo [4, 3 -b] pyridazine compounds as inhibitors of the c-met tyrosine kinase | 20110210 |
EP-2467383-A1 | Heterocyclic oxime compounds | 20090820 |
US-2011065708-A1 | Heterocyclic oxime compounds | 20090820 |
Complexity: | 300 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 237.06013485 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 237.06013485 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 50.2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS