2-[4-(Methylthio)phenoxy]acetonitrile - CAS 43111-34-8
Catalog: |
BB025325 |
Product Name: |
2-[4-(Methylthio)phenoxy]acetonitrile |
CAS: |
43111-34-8 |
Synonyms: |
2-[4-(methylthio)phenoxy]acetonitrile; 2-(4-methylsulfanylphenoxy)acetonitrile |
IUPAC Name: | 2-(4-methylsulfanylphenoxy)acetonitrile |
Description: | 2-[4-(Methylthio)phenoxy]acetonitrile (CAS# 43111-34-8 ) is a useful research chemical. |
Molecular Weight: | 179.24 |
Molecular Formula: | C9H9NOS |
Canonical SMILES: | CSC1=CC=C(C=C1)OCC#N |
InChI: | InChI=1S/C9H9NOS/c1-12-9-4-2-8(3-5-9)11-7-6-10/h2-5H,7H2,1H3 |
InChI Key: | JTRGPOKLBRTMPG-UHFFFAOYSA-N |
LogP: | 2.31088 |
Publication Number | Title | Priority Date |
US-2007060663-A1 | Photocurable composition, photocurable ink composition, printing method and resist composition using the same | 20050915 |
EP-0705251-A1 | Imidazole derivatives as therapeutic agents | 19930622 |
US-5780642-A | Imidazole derivatives as therapeutic agents | 19930622 |
US-6031109-A | Phenoxy-, phenylthio-, benzoyl-alkyleneaminoalkylene-imidazole derivatives as therapeutic agents | 19930622 |
US-6215001-B1 | Imidazole derivatives as therapeutic agents | 19930622 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 179.04048508 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 179.04048508 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 58.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS