2-(4-Methoxyphenyl)morpholine - CAS 83555-74-2
Catalog: |
BB037051 |
Product Name: |
2-(4-Methoxyphenyl)morpholine |
CAS: |
83555-74-2 |
Synonyms: |
2-(4-methoxyphenyl)morpholine; 2-(4-methoxyphenyl)morpholine |
IUPAC Name: | 2-(4-methoxyphenyl)morpholine |
Description: | 2-(4-Methoxyphenyl)morpholine (CAS# 83555-74-2) is a useful research chemical. |
Molecular Weight: | 193.24 |
Molecular Formula: | C11H15NO2 |
Canonical SMILES: | COC1=CC=C(C=C1)C2CNCCO2 |
InChI: | InChI=1S/C11H15NO2/c1-13-10-4-2-9(3-5-10)11-8-12-6-7-14-11/h2-5,11-12H,6-8H2,1H3 |
InChI Key: | PLULTGXHWIAVIR-UHFFFAOYSA-N |
Boiling Point: | 321.7 ℃ at 760 mmHg |
Density: | 1.063 g/cm3 |
Appearance: | Pale-yellow to yellow-brown solid |
LogP: | 1.68490 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
JP-2012229185-A | Aniline derivative | 20110427 |
EP-2502909-A1 | Aminopyridine derivative | 20091118 |
JP-WO2011062194-A1 | Aminopyridine derivatives | 20091118 |
US-2013005710-A1 | Aminopyridine derivative | 20091118 |
WO-2011062194-A1 | Aminopyridine derivative | 20091118 |
Complexity: | 167 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 193.110278721 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.110278721 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 30.5 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Morpholines/Thiomorpholines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS