(2,4-Dioxo-1,3-thiazolidin-5-yl)acetic acid - CAS 875-97-8
Catalog: |
BB038538 |
Product Name: |
(2,4-Dioxo-1,3-thiazolidin-5-yl)acetic acid |
CAS: |
875-97-8 |
Synonyms: |
2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid |
IUPAC Name: | 2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetic acid |
Description: | (2,4-Dioxo-1,3-thiazolidin-5-yl)acetic acid (CAS# 875-97-8) is a useful research chemical. |
Molecular Weight: | 175.16 |
Molecular Formula: | C5H5NO4S |
Canonical SMILES: | C(C1C(=O)NC(=O)S1)C(=O)O |
InChI: | InChI=1S/C5H5NO4S/c7-3(8)1-2-4(9)6-5(10)11-2/h2H,1H2,(H,7,8)(H,6,9,10) |
InChI Key: | NYOCHSASHNVXRM-UHFFFAOYSA-N |
Boiling Point: | 489.3 °C at 760 mmHg |
Density: | 1.6 g/cm3 |
LogP: | 0.14150 |
Publication Number | Title | Priority Date |
WO-2018145217-A1 | Human ets-related gene (erg) compounds as therapeutics and methods for their use | 20170213 |
EP-3018126-A1 | Heterocyclic compound | 20130703 |
US-10053468-B2 | Heterocyclic compound | 20130703 |
US-2017050974-A1 | Heterocyclic compound | 20130703 |
US-2018319812-A1 | Heterocyclic compound | 20130703 |
PMID | Publication Date | Title | Journal |
22123321 | 20120101 | Synthesis and antihyperglycemic evaluation of new 2,4-thiazolidinediones having biodynamic aryl sulfonylurea moieties | Bioorganic & medicinal chemistry letters |
18666428 | 20080301 | Synthesis of amides of 2,4-dioxothiazolidin-5-yl acetic acid with 1,2,4-triazole substituents | Acta poloniae pharmaceutica |
Complexity: | 227 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.99392881 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.99392881 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 109 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Thiazolines/Thiazolidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS