(2,4-Dimethyl-1,3-oxazol-5-yl)methanol - CAS 214553-55-6
Catalog: |
BB016877 |
Product Name: |
(2,4-Dimethyl-1,3-oxazol-5-yl)methanol |
CAS: |
214553-55-6 |
Synonyms: |
(2,4-dimethyl-1,3-oxazol-5-yl)methanol |
IUPAC Name: | (2,4-dimethyl-1,3-oxazol-5-yl)methanol |
Description: | (2,4-Dimethyl-1,3-oxazol-5-yl)methanol (CAS# 214553-55-6) is a useful research chemical. |
Molecular Weight: | 127.14 |
Molecular Formula: | C6H9NO2 |
Canonical SMILES: | CC1=C(OC(=N1)C)CO |
InChI: | InChI=1S/C6H9NO2/c1-4-6(3-8)9-5(2)7-4/h8H,3H2,1-2H3 |
InChI Key: | BFWHIILNKOBBPE-UHFFFAOYSA-N |
Purity: | 95 % |
MDL: | MFCD10699443 |
LogP: | 0.78370 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-3255044-B1 | Diaza-benzofluoranthrene compounds | 20150204 |
US-10017507-B2 | Diaza-benzofluoranthrene compounds | 20150204 |
US-2018016270-A1 | Diaza-benzofluoranthrene compounds | 20150204 |
AU-2013403336-A1 | Secondary alcohol quinolinyl modulators of RORyt | 20131015 |
CA-2926313-A1 | Secondary alcohol quinolinyl modulators of roryt | 20131015 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 127.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 127.063328530 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 46.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxygen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS