2,4-Difluoro-5-methylbenzyl Alcohol - CAS 315204-46-7
Catalog: |
BB020958 |
Product Name: |
2,4-Difluoro-5-methylbenzyl Alcohol |
CAS: |
315204-46-7 |
Synonyms: |
(2,4-difluoro-5-methylphenyl)methanol; (2,4-difluoro-5-methylphenyl)methanol |
IUPAC Name: | (2,4-difluoro-5-methylphenyl)methanol |
Description: | 2,4-Difluoro-5-methylbenzyl Alcohol (CAS# 315204-46-7 ) is a useful research chemical. |
Molecular Weight: | 158.15 |
Molecular Formula: | C8H8F2O |
Canonical SMILES: | CC1=CC(=C(C=C1F)F)CO |
InChI: | InChI=1S/C8H8F2O/c1-5-2-6(4-11)8(10)3-7(5)9/h2-3,11H,4H2,1H3 |
InChI Key: | NDVLGPFATXCWGQ-UHFFFAOYSA-N |
LogP: | 1.76550 |
Publication Number | Title | Priority Date |
US-2013143906-A1 | Substituted pyrimidinone-phenyl-pyrimidinyl compounds | 20111206 |
US-9056110-B2 | Substituted pyrimidinone-phenyl-pyrimidinyl compounds | 20111206 |
WO-2013086208-A1 | Substituted pyrimidinone-phenyl-pyrimidinyl compounds | 20111206 |
US-9040693-B2 | Fused heterocyclic derivative, medicinal composition containing the same, and medicinal use thereof | 20051019 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 158.0543212 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 158.0543212 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 20.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS