2,4-Dichlorothiazole - CAS 4175-76-2
Catalog: |
BB024951 |
Product Name: |
2,4-Dichlorothiazole |
CAS: |
4175-76-2 |
Synonyms: |
2,4-dichlorothiazole; 2,4-dichloro-1,3-thiazole |
IUPAC Name: | 2,4-dichloro-1,3-thiazole |
Description: | 2,4-Dichlorothiazole (CAS# 4175-76-2) is a useful research chemical. |
Molecular Weight: | 154.02 |
Molecular Formula: | C3HCl2NS |
Canonical SMILES: | C1=C(N=C(S1)Cl)Cl |
InChI: | InChI=1S/C3HCl2NS/c4-2-1-7-3(5)6-2/h1H |
InChI Key: | ICETWLGKJXCIDX-UHFFFAOYSA-N |
Boiling Point: | 226.855 °C at 760 mmHg |
Density: | 1.603 g/cm3 |
MDL: | MFCD08691358 |
LogP: | 2.44990 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021123237-A1 | 2-amino-n-(amino-oxo-aryl-lambda6-sulfanylidene)acetamide compounds and their therapeutic use | 20191219 |
CN-110734456-A | compounds, preparation method and medical application thereof | 20191106 |
WO-2020247804-A1 | Heterocycle substituted pyridine derivative antifungal agents | 20190607 |
KR-20200035905-A | Novel compound and organic light emitting device comprising the same | 20180927 |
KR-102225488-B1 | Novel compound and organic light emitting device comprising the same | 20180927 |
Complexity: | 70 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 152.9206756 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 152.9206756 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS