2,4-Dichloropyrimidine-5-sulfonyl Chloride - CAS 23920-08-3
Catalog: |
BB018246 |
Product Name: |
2,4-Dichloropyrimidine-5-sulfonyl Chloride |
CAS: |
23920-08-3 |
Synonyms: |
2,4-dichloro-5-pyrimidinesulfonyl chloride; 2,4-dichloropyrimidine-5-sulfonyl chloride |
IUPAC Name: | 2,4-dichloropyrimidine-5-sulfonyl chloride |
Description: | 2,4-Dichloropyrimidine-5-sulfonyl Chloride (CAS# 23920-08-3) is a useful research chemical. |
Molecular Weight: | 247.49 |
Molecular Formula: | C4HCl3N2O2S |
Canonical SMILES: | C1=C(C(=NC(=N1)Cl)Cl)S(=O)(=O)Cl |
InChI: | InChI=1S/C4HCl3N2O2S/c5-3-2(12(7,10)11)1-8-4(6)9-3/h1H |
InChI Key: | ZPTJJFUQGKXOKC-UHFFFAOYSA-N |
MDL: | MFCD09042631 |
LogP: | 2.79170 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021063207-A1 | Jnk inhibitor, and pharmaceutical composition and use thereof | 20190930 |
EP-1453516-A2 | Novel tri-substituted pyrimidines, method for production and use thereof as medicament | 20011017 |
US-2003134838-A1 | Trisubstituted pyrimidines | 20011017 |
US-2005090486-A1 | Trisubstituted pyrimidines | 20011017 |
US-7166599-B2 | Trisubstituted pyrimidines | 20011017 |
Complexity: | 252 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 245.882432 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 245.882432 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 68.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS