2,4-Dichloropyridine-3-carboxaldehyde - CAS 134031-24-6
Catalog: |
BB007864 |
Product Name: |
2,4-Dichloropyridine-3-carboxaldehyde |
CAS: |
134031-24-6 |
Synonyms: |
2,4-dichloropyridine-3-carbaldehyde |
IUPAC Name: | 2,4-dichloropyridine-3-carbaldehyde |
Description: | 2,4-Dichloropyridine-3-carboxaldehyde (CAS# 134031-24-6) is a useful research chemical. |
Molecular Weight: | 176.00 |
Molecular Formula: | C6H3Cl2NO |
Canonical SMILES: | C1=CN=C(C(=C1Cl)C=O)Cl |
InChI: | InChI=1S/C6H3Cl2NO/c7-5-1-2-9-6(8)4(5)3-10/h1-3H |
InChI Key: | GWBHJHIZHNTJLA-UHFFFAOYSA-N |
Boiling Point: | 261.8 ℃ at 760 mmHg |
Purity: | 95 % |
Density: | 1.488 g/cm3 |
MDL: | MFCD07437909 |
LogP: | 2.20090 |
GHS Hazard Statement: | H302 (97.56%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021133915-A1 | Ectonucleotide pyrophosphatase/phosphodiesterase 1 (enpp1) modulators and uses thereof | 20191223 |
WO-2021043245-A1 | Hydantoin derivative | 20190906 |
WO-2021004535-A1 | Cinnolines as inhibitors of hpk 1 | 20190711 |
WO-2020160710-A1 | Imidazo [2, 1-f] [1, 2, 4] triazin-4-amine derivatives as tlr7 agonist | 20190207 |
WO-2020160711-A1 | Imidazo [2, 1-f] [1, 2, 4] triazin-4-amine derivatives as tlr7 agonist | 20190207 |
Complexity: | 131 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 174.9591691 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 174.9591691 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 30 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS