2,4-Dichlorobenzylsulfonyl chloride - CAS 88691-50-3
Catalog: |
BB039153 |
Product Name: |
2,4-Dichlorobenzylsulfonyl chloride |
CAS: |
88691-50-3 |
Synonyms: |
(2,4-dichlorophenyl)methanesulfonyl chloride |
IUPAC Name: | (2,4-dichlorophenyl)methanesulfonyl chloride |
Description: | 2,4-Dichlorobenzylsulfonyl chloride (CAS# 88691-50-3) is a useful research chemical. |
Molecular Weight: | 259.54 |
Molecular Formula: | C7H5Cl3O2S |
Canonical SMILES: | C1=CC(=C(C=C1Cl)Cl)CS(=O)(=O)Cl |
InChI: | InChI=1S/C7H5Cl3O2S/c8-6-2-1-5(7(9)3-6)4-13(10,11)12/h1-3H,4H2 |
InChI Key: | SNLHLLYEHFIELA-UHFFFAOYSA-N |
Boiling Point: | 350.6 °C at 760 mmHg |
Density: | 1.601 g/cm3 |
LogP: | 4.14280 |
GHS Hazard Statement: | H314 (97.44%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
EP-3126329-A1 | N-hydroxymethanesulfonamide nitroxyl donors | 20140117 |
EP-3126329-B1 | N-hydroxymethanesulfonamide nitroxyl donors | 20140117 |
ES-2734060-T3 | Nitroxyl donors of N-hydroxymethanesulfonamide | 20140117 |
US-2016046569-A1 | N-hydroxymethanesulfonamide nitroxyl donors | 20140117 |
US-9932303-B2 | N-hydroxymethanesulfonamide nitroxyl donors | 20140117 |
Complexity: | 259 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 257.907584 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 257.907584 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS