2,4-Dichlorobenzotrifluoride - CAS 320-60-5
Catalog: |
BB021151 |
Product Name: |
2,4-Dichlorobenzotrifluoride |
CAS: |
320-60-5 |
Synonyms: |
2,4-dichloro-1-(trifluoromethyl)benzene |
IUPAC Name: | 2,4-dichloro-1-(trifluoromethyl)benzene |
Description: | 2,4-Dichlorobenzotrifluoride (CAS# 320-60-5) is a potential intermediate in the synthesis of endocrine disrupter. |
Molecular Weight: | 215.00 |
Molecular Formula: | C7H3Cl2F3 |
Canonical SMILES: | C1=CC(=C(C=C1Cl)Cl)C(F)(F)F |
InChI: | InChI=1S/C7H3Cl2F3/c8-4-1-2-5(6(9)3-4)7(10,11)12/h1-3H |
InChI Key: | KALSHRGEFLVFHE-UHFFFAOYSA-N |
Boiling Point: | 117-118 °C |
Purity: | 98 % |
Density: | 1.48 g/cm3 |
Appearance: | Clear colourless liquid |
MDL: | MFCD00000582 |
LogP: | 4.01220 |
Vapor Pressure: | 1.11 [mmHg] |
GHS Hazard Statement: | H314 (97.78%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112358401-A | Preparation method of 2, 4-dichloro-3, 5-dinitrobenzotrifluoride | 20201122 |
CN-112174826-A | Process for synthesizing nitro diether by adopting narrow-distance parallel flat plate reactor | 20201015 |
CN-111883842-A | Functional non-aqueous organic additive for non-aqueous electrolyte | 20200807 |
CN-111533660-A | Preparation method of 2, 4-dichloro-3, 5-dinitrobenzotrifluoride | 20200518 |
AU-2021102631-A4 | Method for preparing 2,4-dichloro-3,5-dinitrobenzotrifluoride | 20200518 |
Complexity: | 157 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 213.95639 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 213.95639 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Halides
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS