2,4-Dichloro-8-fluoroquinazoline - CAS 959237-64-0
Catalog: |
BB041893 |
Product Name: |
2,4-Dichloro-8-fluoroquinazoline |
CAS: |
959237-64-0 |
Synonyms: |
2,4-dichloro-8-fluoroquinazoline; 2,4-dichloro-8-fluoroquinazoline |
IUPAC Name: | 2,4-dichloro-8-fluoroquinazoline |
Description: | 2,4-Dichloro-8-fluoroquinazoline (CAS# 959237-64-0) is a useful research chemical. |
Molecular Weight: | 217.03 |
Molecular Formula: | C8H3Cl2FN2 |
Canonical SMILES: | C1=CC2=C(C(=C1)F)N=C(N=C2Cl)Cl |
InChI: | InChI=1S/C8H3Cl2FN2/c9-7-4-2-1-3-5(11)6(4)12-8(10)13-7/h1-3H |
InChI Key: | VXSUTXKJWJUPLJ-UHFFFAOYSA-N |
Boiling Point: | 277.3 °C at 760 mmHg |
Density: | 1.571 g/cm3 |
Storage: | Inert atmosphere, 2-8 °C |
LogP: | 3.07570 |
Publication Number | Title | Priority Date |
WO-2021130638-A1 | Diacylglycerol kinase modulating compounds | 20191224 |
WO-2019118313-A1 | Imidazo [1,2-c] quinazolin-5-amine compounds with a2a antagonist properties | 20171213 |
EP-3723754-A1 | Imidazo [1,2-c] quinazolin-5-amine compounds with a2a antagonist properties | 20171213 |
US-2021053973-A1 | Imidazo[1,2-c]quinazolin-5-amine compounds with a2a antagonist properties | 20171213 |
US-10501444-B2 | Inhibitors of influenza virus replication, application methods and uses thereof | 20160816 |
Complexity: | 193 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 215.9657317 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 215.9657317 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS