2,4-Dichloro-6-(trifluoromethyl)pyrimidine - CAS 16097-64-6
Catalog: |
BB011693 |
Product Name: |
2,4-Dichloro-6-(trifluoromethyl)pyrimidine |
CAS: |
16097-64-6 |
Synonyms: |
2,4-dichloro-6-(trifluoromethyl)pyrimidine; 2,4-dichloro-6-(trifluoromethyl)pyrimidine |
IUPAC Name: | 2,4-dichloro-6-(trifluoromethyl)pyrimidine |
Description: | 2,4-Dichloro-6-(trifluoromethyl)pyrimidine (CAS# 16097-64-6) is a useful synthetic intermediate. It can be used to synthesize 2,4-diaminopyrimidines derivatives that show antiplasmodial activities. |
Molecular Weight: | 216.98 |
Molecular Formula: | C5HCl2F3N2 |
Canonical SMILES: | C1=C(N=C(N=C1Cl)Cl)C(F)(F)F |
InChI: | InChI=1S/C5HCl2F3N2/c6-3-1-2(5(8,9)10)11-4(7)12-3/h1H |
InChI Key: | ZTNFYAJHLPMNSN-UHFFFAOYSA-N |
Boiling Point: | 206.9 ℃ at 760 mmHg |
Density: | 1.627 g/cm3 |
MDL: | MFCD09910264 |
LogP: | 2.80220 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111423420-A | Fused ring compounds as ketohexokinase inhibitors | 20200430 |
CN-113149968-A | Compound serving as ketohexokinase inhibitor and application thereof | 20200430 |
WO-2021162943-A1 | 2-[2-methylazetidin-1-yl]-4-phenyl-6-(trifluoromethyl)-pyrimidine compounds | 20200213 |
WO-2021155317-A1 | Asgpr-binding compounds for the degradation of extracellular proteins | 20200131 |
KR-20210081285-A | Novel Amide Derivatives and Their Use as Inhibitors against Diacylglycerol Acyltransferase 2 | 20191223 |
Complexity: | 163 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 215.9468879 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 215.9468879 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 25.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS