2,4-Dichloro-6-methylpyridine - CAS 42779-56-6
Catalog: |
BB025221 |
Product Name: |
2,4-Dichloro-6-methylpyridine |
CAS: |
42779-56-6 |
Synonyms: |
2,4-dichloro-6-methylpyridine; 2,4-dichloro-6-methylpyridine |
IUPAC Name: | 2,4-dichloro-6-methylpyridine |
Description: | 2,4-Dichloro-6-methylpyridine (CAS# 42779-56-6) is a useful research chemical. |
Molecular Weight: | 162.02 |
Molecular Formula: | C6H5Cl2N |
Canonical SMILES: | CC1=NC(=CC(=C1)Cl)Cl |
InChI: | InChI=1S/C6H5Cl2N/c1-4-2-5(7)3-6(8)9-4/h2-3H,1H3 |
InChI Key: | WUGTXQVNSRFDNV-UHFFFAOYSA-N |
Boiling Point: | 209.993 °C at 760 mmHg |
Density: | 1.319 g/cm3 |
MDL: | MFCD08669834 |
LogP: | 2.69680 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021118887-A1 | Cgrp antigonists useful as tracer compounds for positron emission tomography | 20191212 |
WO-2021012018-A1 | Inhibitor compounds | 20190724 |
WO-2021016102-A1 | Inhibitors of tyrosine kinase | 20190719 |
WO-2021008607-A1 | Substituted 1,2,4-triazolo[4,3-a]pyridine derivative and preparation method, herbicidal composition and application thereof | 20190718 |
KR-20210081353-A | Heterocyclic kinase inhibitors and uses thereof | 20181023 |
Complexity: | 97.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.9799046 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.9799046 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS