2,4-Dichloro-6-methyl-5-nitropyrimidine - CAS 13162-26-0
Catalog: |
BB007458 |
Product Name: |
2,4-Dichloro-6-methyl-5-nitropyrimidine |
CAS: |
13162-26-0 |
Synonyms: |
2,4-dichloro-6-methyl-5-nitropyrimidine; 2,4-dichloro-6-methyl-5-nitropyrimidine |
IUPAC Name: | 2,4-dichloro-6-methyl-5-nitropyrimidine |
Description: | A synthetic intermediate. |
Molecular Weight: | 208.00 |
Molecular Formula: | C5H3Cl2N3O2 |
Canonical SMILES: | CC1=C(C(=NC(=N1)Cl)Cl)[N+](=O)[O-] |
InChI: | InChI=1S/C5H3Cl2N3O2/c1-2-3(10(11)12)4(6)9-5(7)8-2/h1H3 |
InChI Key: | NBCOZXBHPKSFSA-UHFFFAOYSA-N |
Boiling Point: | 311.8 ℃ at 760 mmHg |
Purity: | 98 % |
Density: | 1.626 g/cm3 |
Appearance: | Yellow crystalline solid |
Storage: | Inert atmosphere, 2-8 ℃ |
MDL: | MFCD00023196 |
LogP: | 2.52320 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111732535-A | Photochemical synthesis method of heteroaryl amine compound | 20200810 |
CN-111732535-B | Photochemical synthesis method of heteroaryl amine compound | 20200810 |
WO-2020221239-A1 | Oxaazaquinazoline-7(8h)-ketone compound, preparation method therfor and pharmaceutical application thereof | 20190428 |
EP-3717464-A1 | Nitration | 20181026 |
CN-113302186-A | Nitration | 20181026 |
Complexity: | 186 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 206.9602317 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 206.9602317 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 71.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Pyrimidines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS